About 2,3-dihydrocyclohepta[d][1,3]oxazole
2,3-dihydrocyclohepta[d][1,3]oxazole (PubChem CID 123811482) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2,3-dihydrocyclohepta[d][1,3]oxazole.
Molecular Properties
| Compound Name | 2,3-dihydrocyclohepta[d][1,3]oxazole |
| PubChem CID | 123811482 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 2,3-dihydrocyclohepta[d][1,3]oxazole |
| SMILES | C1=CC=C2NCOC2=CC=1 |
| InChI | InChI=1S/C8H7NO/c1-2-4-7-8(5-3-1)10-6-9-7/h2-5,9H,6H2 |
| InChIKey | DNKBTTXLVVJJNG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydrocyclohepta[d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrocyclohepta[d][1,3]oxazole?
The IUPAC name of 2,3-dihydrocyclohepta[d][1,3]oxazole (CID 123811482) is 2,3-dihydrocyclohepta[d][1,3]oxazole.
What is the SMILES notation for 2,3-dihydrocyclohepta[d][1,3]oxazole?
The canonical SMILES for 2,3-dihydrocyclohepta[d][1,3]oxazole is C1=CC=C2NCOC2=CC=1.
What is the InChIKey of 2,3-dihydrocyclohepta[d][1,3]oxazole?
The InChIKey is DNKBTTXLVVJJNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c1-2-4-7-8(5-3-1)10-6-9-7/h2-5,9H,6H2.
What are the key properties of 2,3-dihydrocyclohepta[d][1,3]oxazole?
2,3-dihydrocyclohepta[d][1,3]oxazole has a molecular weight of 133.15 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrocyclohepta[d][1,3]oxazole is sourced from PubChem (CID 123811482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).