C10H18N3+ — CID 123811593
4,5-ditert-butyl-1,3-diaza-2-azoniacyclopenta-1,2,4-triene (PubChem CID 123811593) has the molecular formula C10H18N3+ and a molecular weight of 180.27 g/mol. Its IUPAC name is 4,5-ditert-butyl-1,3-diaza-2-azoniacyclopenta-1,2,4-triene.
| Compound Name | 4,5-ditert-butyl-1,3-diaza-2-azoniacyclopenta-1,2,4-triene |
|---|---|
| PubChem CID | 123811593 |
| Molecular Formula | C10H18N3+ |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 4,5-ditert-butyl-1,3-diaza-2-azoniacyclopenta-1,2,4-triene |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)N=[N+]=N1 |
| InChI | InChI=1S/C10H18N3/c1-9(2,3)7-8(10(4,5)6)12-13-11-7/h1-6H3/q+1 |
| InChIKey | XHHBPQZGJZGWDM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|