C22H26F3N3O3 — CID 123812017
1-[3a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]piperidin-4-one (PubChem CID 123812017) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 1-[3a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]piperidin-4-one.
| Compound Name | 1-[3a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]piperidin-4-one |
|---|---|
| PubChem CID | 123812017 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-[3a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl]piperidin-4-one |
| SMILES | O=C1CCN(C2CC3OCCC3(C(=O)N3CCc4ncc(C(F)(F)F)cc4C3)C2)CC1 |
| InChI | InChI=1S/C22H26F3N3O3/c23-22(24,25)15-9-14-13-28(7-3-18(14)26-12-15)20(30)21-4-8-31-19(21)10-16(11-21)27-5-1-17(29)2-6-27/h9,12,16,19H,1-8,10-11,13H2 |
| InChIKey | MEUGXDQEQVSMFY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |