C24H28F3NO4S — CID 123812153
5-[3-(3-methylphenyl)sulfonylcyclobutyl]-1-[6-(3,3,3-trifluoropropoxy)-3-pyridinyl]pentan-1-one (PubChem CID 123812153) has the molecular formula C24H28F3NO4S and a molecular weight of 483.55 g/mol. Its IUPAC name is 5-[3-(3-methylphenyl)sulfonylcyclobutyl]-1-[6-(3,3,3-trifluoropropoxy)-3-pyridinyl]pentan-1-one.
| Compound Name | 5-[3-(3-methylphenyl)sulfonylcyclobutyl]-1-[6-(3,3,3-trifluoropropoxy)-3-pyridinyl]pentan-1-one |
|---|---|
| PubChem CID | 123812153 |
| Molecular Formula | C24H28F3NO4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 5-[3-(3-methylphenyl)sulfonylcyclobutyl]-1-[6-(3,3,3-trifluoropropoxy)-3-pyridinyl]pentan-1-one |
| SMILES | Cc1cccc(S(=O)(=O)C2CC(CCCCC(=O)c3ccc(OCCC(F)(F)F)nc3)C2)c1 |
| InChI | InChI=1S/C24H28F3NO4S/c1-17-5-4-7-20(13-17)33(30,31)21-14-18(15-21)6-2-3-8-22(29)19-9-10-23(28-16-19)32-12-11-24(25,26)27/h4-5,7,9-10,13,16,18,21H,2-3,6,8,11-12,14-15H2,1H3 |
| InChIKey | FRBAAVWBNJTIMR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|