About 4-ethynyl-1,3-dimethylcyclohexene
4-ethynyl-1,3-dimethylcyclohexene (PubChem CID 123812267) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 4-ethynyl-1,3-dimethylcyclohexene.
Molecular Properties
| Compound Name | 4-ethynyl-1,3-dimethylcyclohexene |
| PubChem CID | 123812267 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 4-ethynyl-1,3-dimethylcyclohexene |
| SMILES | C#CC1CCC(C)=CC1C |
| InChI | InChI=1S/C10H14/c1-4-10-6-5-8(2)7-9(10)3/h1,7,9-10H,5-6H2,2-3H3 |
| InChIKey | DENQFWVRZNXJFF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-1,3-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-1,3-dimethylcyclohexene?
The IUPAC name of 4-ethynyl-1,3-dimethylcyclohexene (CID 123812267) is 4-ethynyl-1,3-dimethylcyclohexene.
What is the SMILES notation for 4-ethynyl-1,3-dimethylcyclohexene?
The canonical SMILES for 4-ethynyl-1,3-dimethylcyclohexene is C#CC1CCC(C)=CC1C.
What is the InChIKey of 4-ethynyl-1,3-dimethylcyclohexene?
The InChIKey is DENQFWVRZNXJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-4-10-6-5-8(2)7-9(10)3/h1,7,9-10H,5-6H2,2-3H3.
What are the key properties of 4-ethynyl-1,3-dimethylcyclohexene?
4-ethynyl-1,3-dimethylcyclohexene has a molecular weight of 134.22 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-1,3-dimethylcyclohexene is sourced from PubChem (CID 123812267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).