C30H54F2N8O2+2 — CID 123812436
3,3-diamino-N-[1-cyclohexyl-5-fluoro-4-[4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]-2-(3,3-diethyl-5-fluoro-1-methyl-2,4-dihydropyrimidine-1,3-diium-2-yl)propanamide (PubChem CID 123812436) has the molecular formula C30H54F2N8O2+2 and a molecular weight of 596.81 g/mol. Its IUPAC name is 3,3-diamino-N-[1-cyclohexyl-5-fluoro-4-[4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]-2-(3,3-diethyl-5-fluoro-1-methyl-2,4-dihydropyrimidine-1,3-diium-2-yl)propanamide.
| Compound Name | 3,3-diamino-N-[1-cyclohexyl-5-fluoro-4-[4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]-2-(3,3-diethyl-5-fluoro-1-methyl-2,4-dihydropyrimidine-1,3-diium-2-yl)propanamide |
|---|---|
| PubChem CID | 123812436 |
| Molecular Formula | C30H54F2N8O2+2 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.43 |
| IUPAC Name | 3,3-diamino-N-[1-cyclohexyl-5-fluoro-4-[4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]-2-(3,3-diethyl-5-fluoro-1-methyl-2,4-dihydropyrimidine-1,3-diium-2-yl)propanamide |
| SMILES | CC[N+]1(CC)CC(F)=C=[N+](C)C1C(C(=O)NC1CN(C2CCCCC2)CC(F)C1N1CCN(C2COC2)CC1)C(N)N |
| InChI | InChI=1S/C30H53F2N8O2/c1-4-40(5-2)18-21(31)15-36(3)30(40)26(28(33)34)29(41)35-25-17-39(22-9-7-6-8-10-22)16-24(32)27(25)38-13-11-37(12-14-38)23-19-42-20-23/h22-28,30H,4-14,16-20,33-34H2,1-3H3/q+1/p+1 |
| InChIKey | OXRLWHGHSSEIRE-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|