C21H13F10N3O2 — CID 123812634
3,3,3-trifluoro-1-[3-fluoro-3-[5-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-2H-1,2-oxazol-3-yl]-2-pyridinyl]azetidin-1-yl]propan-1-one (PubChem CID 123812634) has the molecular formula C21H13F10N3O2 and a molecular weight of 529.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-[3-fluoro-3-[5-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-2H-1,2-oxazol-3-yl]-2-pyridinyl]azetidin-1-yl]propan-1-one.
| Compound Name | 3,3,3-trifluoro-1-[3-fluoro-3-[5-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-2H-1,2-oxazol-3-yl]-2-pyridinyl]azetidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 123812634 |
| Molecular Formula | C21H13F10N3O2 |
| Molecular Weight | 529.33 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 3,3,3-trifluoro-1-[3-fluoro-3-[5-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-2H-1,2-oxazol-3-yl]-2-pyridinyl]azetidin-1-yl]propan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CC(F)(c2ccc(C3=CC(c4cc(F)c(F)c(F)c4)(C(F)(F)F)ON3)cn2)C1 |
| InChI | InChI=1S/C21H13F10N3O2/c22-12-3-11(4-13(23)17(12)24)19(21(29,30)31)5-14(33-36-19)10-1-2-15(32-7-10)18(25)8-34(9-18)16(35)6-20(26,27)28/h1-5,7,33H,6,8-9H2 |
| InChIKey | OIAPXYXSYKORTL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|