C26H39NO — CID 123812720
N-(4-but-2-en-2-ylhepta-2,4-dienyl)-3-methylidene-N-(4-methylocta-1,2,4-trien-3-yl)pentanamide (PubChem CID 123812720) has the molecular formula C26H39NO and a molecular weight of 381.60 g/mol. Its IUPAC name is N-(4-but-2-en-2-ylhepta-2,4-dienyl)-3-methylidene-N-(4-methylocta-1,2,4-trien-3-yl)pentanamide.
| Compound Name | N-(4-but-2-en-2-ylhepta-2,4-dienyl)-3-methylidene-N-(4-methylocta-1,2,4-trien-3-yl)pentanamide |
|---|---|
| PubChem CID | 123812720 |
| Molecular Formula | C26H39NO |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | N-(4-but-2-en-2-ylhepta-2,4-dienyl)-3-methylidene-N-(4-methylocta-1,2,4-trien-3-yl)pentanamide |
| SMILES | C=C=C(C(C)=CCCC)N(CC=CC(=CCC)C(C)=CC)C(=O)CC(=C)CC |
| InChI | InChI=1S/C26H39NO/c1-9-14-17-23(8)25(13-5)27(26(28)20-21(6)11-3)19-15-18-24(16-10-2)22(7)12-4/h12,15-18H,5-6,9-11,14,19-20H2,1-4,7-8H3 |
| InChIKey | WCHKAHORVWYYIO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|