C13H25NO4Si — CID 123813646
[4-oxo-3-(2,2,4-trimethyl-4-silyloxypentan-3-yl)azetidin-2-yl] acetate (PubChem CID 123813646) has the molecular formula C13H25NO4Si and a molecular weight of 287.43 g/mol. Its IUPAC name is [4-oxo-3-(2,2,4-trimethyl-4-silyloxypentan-3-yl)azetidin-2-yl] acetate.
| Compound Name | [4-oxo-3-(2,2,4-trimethyl-4-silyloxypentan-3-yl)azetidin-2-yl] acetate |
|---|---|
| PubChem CID | 123813646 |
| Molecular Formula | C13H25NO4Si |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [4-oxo-3-(2,2,4-trimethyl-4-silyloxypentan-3-yl)azetidin-2-yl] acetate |
| SMILES | CC(=O)OC1NC(=O)C1C(C(C)(C)C)C(C)(C)O[SiH3] |
| InChI | InChI=1S/C13H25NO4Si/c1-7(15)17-11-8(10(16)14-11)9(12(2,3)4)13(5,6)18-19/h8-9,11H,1-6,19H3,(H,14,16) |
| InChIKey | XPUWIOZERXJNSC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|