C32H39BrN3+ — CID 123813696
16-bromo-13-tert-butyl-20,21-diethyl-20,21-dimethyl-12,14-diaza-1-azoniaheptacyclo[13.6.2.25,8.02,11.04,9.012,22.019,23]pentacosa-1(22),2(11),3,9,13,15,17,19(23)-octaene (PubChem CID 123813696) has the molecular formula C32H39BrN3+ and a molecular weight of 545.59 g/mol. Its IUPAC name is 16-bromo-13-tert-butyl-20,21-diethyl-20,21-dimethyl-12,14-diaza-1-azoniaheptacyclo[13.6.2.25,8.02,11.04,9.012,22.019,23]pentacosa-1(22),2(11),3,9,13,15,17,19(23)-octaene.
| Compound Name | 16-bromo-13-tert-butyl-20,21-diethyl-20,21-dimethyl-12,14-diaza-1-azoniaheptacyclo[13.6.2.25,8.02,11.04,9.012,22.019,23]pentacosa-1(22),2(11),3,9,13,15,17,19(23)-octaene |
|---|---|
| PubChem CID | 123813696 |
| Molecular Formula | C32H39BrN3+ |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 16-bromo-13-tert-butyl-20,21-diethyl-20,21-dimethyl-12,14-diaza-1-azoniaheptacyclo[13.6.2.25,8.02,11.04,9.012,22.019,23]pentacosa-1(22),2(11),3,9,13,15,17,19(23)-octaene |
| SMILES | CCC1(C)c2ccc(Br)c3nc(C(C)(C)C)n4c5cc6c(cc5[n+](c4c23)C1(C)CC)C1CCC6CC1 |
| InChI | InChI=1S/C32H39BrN3/c1-8-31(6)22-14-15-23(33)27-26(22)28-35(29(34-27)30(3,4)5)24-16-20-18-10-12-19(13-11-18)21(20)17-25(24)36(28)32(31,7)9-2/h14-19H,8-13H2,1-7H3/q+1 |
| InChIKey | WPDFYKJRCCVXOM-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|