C16H15FN2O2 — CID 123813800
2-(3-fluoro-2-methylhepta-2,4-dien-6-ynoxy)-7,8-dihydro-6H-1,6-naphthyridin-5-one (PubChem CID 123813800) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(3-fluoro-2-methylhepta-2,4-dien-6-ynoxy)-7,8-dihydro-6H-1,6-naphthyridin-5-one.
| Compound Name | 2-(3-fluoro-2-methylhepta-2,4-dien-6-ynoxy)-7,8-dihydro-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 123813800 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(3-fluoro-2-methylhepta-2,4-dien-6-ynoxy)-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| SMILES | C#CC=CC(F)=C(C)COc1ccc2c(n1)CCNC2=O |
| InChI | InChI=1S/C16H15FN2O2/c1-3-4-5-13(17)11(2)10-21-15-7-6-12-14(19-15)8-9-18-16(12)20/h1,4-7H,8-10H2,2H3,(H,18,20) |
| InChIKey | RKCWFOXVELKAAQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|