C17H32S — CID 123814941
4,4,7,7,8a-pentamethyl-8-(methylsulfanylmethyl)-2,3,4a,5,6,8-hexahydro-1H-naphthalene (PubChem CID 123814941) has the molecular formula C17H32S and a molecular weight of 268.51 g/mol. Its IUPAC name is 4,4,7,7,8a-pentamethyl-8-(methylsulfanylmethyl)-2,3,4a,5,6,8-hexahydro-1H-naphthalene.
| Compound Name | 4,4,7,7,8a-pentamethyl-8-(methylsulfanylmethyl)-2,3,4a,5,6,8-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 123814941 |
| Molecular Formula | C17H32S |
| Molecular Weight | 268.51 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 4,4,7,7,8a-pentamethyl-8-(methylsulfanylmethyl)-2,3,4a,5,6,8-hexahydro-1H-naphthalene |
| SMILES | CSCC1C(C)(C)CCC2C(C)(C)CCCC21C |
| InChI | InChI=1S/C17H32S/c1-15(2)9-7-10-17(5)13(15)8-11-16(3,4)14(17)12-18-6/h13-14H,7-12H2,1-6H3 |
| InChIKey | PKNAUWDUBPCQGM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |