C10H14O4 — CID 123815726
2,2-diethyl-5-ethylidene-1,3-dioxane-4,6-dione (PubChem CID 123815726) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2,2-diethyl-5-ethylidene-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-diethyl-5-ethylidene-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 123815726 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2,2-diethyl-5-ethylidene-1,3-dioxane-4,6-dione |
| SMILES | CC=C1C(=O)OC(CC)(CC)OC1=O |
| InChI | InChI=1S/C10H14O4/c1-4-7-8(11)13-10(5-2,6-3)14-9(7)12/h4H,5-6H2,1-3H3 |
| InChIKey | RGQQSKMTMKRNMF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|