C29H22ClN5 — CID 123816670
6-chloro-3-(1-methylpyrazol-4-yl)-4-trityl-1H-pyrazolo[4,3-c]pyridine (PubChem CID 123816670) has the molecular formula C29H22ClN5 and a molecular weight of 475.98 g/mol. Its IUPAC name is 6-chloro-3-(1-methylpyrazol-4-yl)-4-trityl-1H-pyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-3-(1-methylpyrazol-4-yl)-4-trityl-1H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 123816670 |
| Molecular Formula | C29H22ClN5 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 6-chloro-3-(1-methylpyrazol-4-yl)-4-trityl-1H-pyrazolo[4,3-c]pyridine |
| SMILES | Cn1cc(-c2n[nH]c3cc(Cl)nc(C(c4ccccc4)(c4ccccc4)c4ccccc4)c23)cn1 |
| InChI | InChI=1S/C29H22ClN5/c1-35-19-20(18-31-35)27-26-24(33-34-27)17-25(30)32-28(26)29(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-19H,1H3,(H,33,34) |
| InChIKey | OYEJOWBIJZMPCY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|