C12H19NO — CID 123818058
[4-(oxan-4-yl)cyclohexa-1,3-dien-1-yl]methanamine (PubChem CID 123818058) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is [4-(oxan-4-yl)cyclohexa-1,3-dien-1-yl]methanamine.
| Compound Name | [4-(oxan-4-yl)cyclohexa-1,3-dien-1-yl]methanamine |
|---|---|
| PubChem CID | 123818058 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | [4-(oxan-4-yl)cyclohexa-1,3-dien-1-yl]methanamine |
| SMILES | NCC1=CC=C(C2CCOCC2)CC1 |
| InChI | InChI=1S/C12H19NO/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1,3,12H,2,4-9,13H2 |
| InChIKey | IILUQOFOEHCHGZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |