C9H15NS2 — CID 123818114
N-methyl-2-methylsulfanyl-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 123818114) has the molecular formula C9H15NS2 and a molecular weight of 201.36 g/mol. Its IUPAC name is N-methyl-2-methylsulfanyl-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | N-methyl-2-methylsulfanyl-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 123818114 |
| Molecular Formula | C9H15NS2 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-methyl-2-methylsulfanyl-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | CSCCN(C)Cc1cccs1 |
| InChI | InChI=1S/C9H15NS2/c1-10(5-7-11-2)8-9-4-3-6-12-9/h3-4,6H,5,7-8H2,1-2H3 |
| InChIKey | NXKBUXZLEPEOMR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |