About 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate
1-(2-fluorophenyl)propan-2-yl N-methylcarbamate (PubChem CID 123818149) has the molecular formula C11H14FNO2
and a molecular weight of 211.24 g/mol. Its IUPAC name is 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate |
| PubChem CID | 123818149 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)Cc1ccccc1F |
| InChI | InChI=1S/C11H14FNO2/c1-8(15-11(14)13-2)7-9-5-3-4-6-10(9)12/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | NBAJCTQAQGMQFZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate?
The IUPAC name of 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate (CID 123818149) is 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate.
What is the SMILES notation for 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate?
The canonical SMILES for 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate is CNC(=O)OC(C)Cc1ccccc1F.
What is the InChIKey of 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate?
The InChIKey is NBAJCTQAQGMQFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO2/c1-8(15-11(14)13-2)7-9-5-3-4-6-10(9)12/h3-6,8H,7H2,1-2H3,(H,13,14).
What are the key properties of 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate?
1-(2-fluorophenyl)propan-2-yl N-methylcarbamate has a molecular weight of 211.24 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)propan-2-yl N-methylcarbamate is sourced from PubChem (CID 123818149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).