About (5-fluoropyrimidin-4-yl) butanoate
(5-fluoropyrimidin-4-yl) butanoate (PubChem CID 123818562) has the molecular formula C8H9FN2O2
and a molecular weight of 184.17 g/mol. Its IUPAC name is (5-fluoropyrimidin-4-yl) butanoate.
Molecular Properties
| Compound Name | (5-fluoropyrimidin-4-yl) butanoate |
| PubChem CID | 123818562 |
| Molecular Formula | C8H9FN2O2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (5-fluoropyrimidin-4-yl) butanoate |
| SMILES | CCCC(=O)Oc1ncncc1F |
| InChI | InChI=1S/C8H9FN2O2/c1-2-3-7(12)13-8-6(9)4-10-5-11-8/h4-5H,2-3H2,1H3 |
| InChIKey | BLABYRQPAJLBET-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-fluoropyrimidin-4-yl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoropyrimidin-4-yl) butanoate?
The IUPAC name of (5-fluoropyrimidin-4-yl) butanoate (CID 123818562) is (5-fluoropyrimidin-4-yl) butanoate.
What is the SMILES notation for (5-fluoropyrimidin-4-yl) butanoate?
The canonical SMILES for (5-fluoropyrimidin-4-yl) butanoate is CCCC(=O)Oc1ncncc1F.
What is the InChIKey of (5-fluoropyrimidin-4-yl) butanoate?
The InChIKey is BLABYRQPAJLBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O2/c1-2-3-7(12)13-8-6(9)4-10-5-11-8/h4-5H,2-3H2,1H3.
What are the key properties of (5-fluoropyrimidin-4-yl) butanoate?
(5-fluoropyrimidin-4-yl) butanoate has a molecular weight of 184.17 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoropyrimidin-4-yl) butanoate is sourced from PubChem (CID 123818562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).