C16H11Cl2F3N2O — CID 123818992
3-[4-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2,5-dihydro-1,2-oxazol-3-yl]aniline (PubChem CID 123818992) has the molecular formula C16H11Cl2F3N2O and a molecular weight of 375.18 g/mol. Its IUPAC name is 3-[4-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2,5-dihydro-1,2-oxazol-3-yl]aniline.
| Compound Name | 3-[4-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2,5-dihydro-1,2-oxazol-3-yl]aniline |
|---|---|
| PubChem CID | 123818992 |
| Molecular Formula | C16H11Cl2F3N2O |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 3-[4-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2,5-dihydro-1,2-oxazol-3-yl]aniline |
| SMILES | Nc1cccc(C2=C(c3cc(Cl)cc(Cl)c3)C(C(F)(F)F)ON2)c1 |
| InChI | InChI=1S/C16H11Cl2F3N2O/c17-10-4-9(5-11(18)7-10)13-14(8-2-1-3-12(22)6-8)23-24-15(13)16(19,20)21/h1-7,15,23H,22H2 |
| InChIKey | UVPNLBOVYIXJEN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|