C26H55NO6P+ — CID 123819232
2-[[(2S)-1,2-dihydroxyhenicos-12-en-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 123819232) has the molecular formula C26H55NO6P+ and a molecular weight of 508.70 g/mol. Its IUPAC name is 2-[[(2S)-1,2-dihydroxyhenicos-12-en-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2S)-1,2-dihydroxyhenicos-12-en-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 123819232 |
| Molecular Formula | C26H55NO6P+ |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | 2-[[(2S)-1,2-dihydroxyhenicos-12-en-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCCC(OP(=O)(O)OCC[N+](C)(C)C)[C@@H](O)CO |
| InChI | InChI=1S/C26H54NO6P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(25(29)24-28)33-34(30,31)32-23-22-27(2,3)4/h12-13,25-26,28-29H,5-11,14-24H2,1-4H3/p+1/t25-,26?/m0/s1 |
| InChIKey | LOKPOKWPERMQMB-PMCHYTPCSA-O |
| XLogP | 5.98 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|