C25H24ClF3N4O5S — CID 123819827
7-[(4-chlorophenyl)methyl]-1-(3-methoxypropyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methylsulfinyl]purine-2,6-dione (PubChem CID 123819827) has the molecular formula C25H24ClF3N4O5S and a molecular weight of 585.00 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(3-methoxypropyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methylsulfinyl]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(3-methoxypropyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methylsulfinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 123819827 |
| Molecular Formula | C25H24ClF3N4O5S |
| Molecular Weight | 585.00 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(3-methoxypropyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methylsulfinyl]purine-2,6-dione |
| SMILES | COCCCn1c(=O)c2c(nc(S(=O)Cc3cccc(OC(F)(F)F)c3)n2Cc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C25H24ClF3N4O5S/c1-31-21-20(22(34)32(24(31)35)11-4-12-37-2)33(14-16-7-9-18(26)10-8-16)23(30-21)39(36)15-17-5-3-6-19(13-17)38-25(27,28)29/h3,5-10,13H,4,11-12,14-15H2,1-2H3 |
| InChIKey | DFXWKUSTONLJNK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.00 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|