C36H33FN4O — CID 123820362
3-[5-[3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-5-fluoro-1H-indol-7-yl]-3,3-dimethylindol-2-yl]-1,5,6,7-tetrahydroindol-4-one (PubChem CID 123820362) has the molecular formula C36H33FN4O and a molecular weight of 556.69 g/mol. Its IUPAC name is 3-[5-[3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-5-fluoro-1H-indol-7-yl]-3,3-dimethylindol-2-yl]-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 3-[5-[3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-5-fluoro-1H-indol-7-yl]-3,3-dimethylindol-2-yl]-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 123820362 |
| Molecular Formula | C36H33FN4O |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 3-[5-[3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-5-fluoro-1H-indol-7-yl]-3,3-dimethylindol-2-yl]-1,5,6,7-tetrahydroindol-4-one |
| SMILES | CC1(C)C(c2c[nH]c3c2C(=O)CCC3)=Nc2ccc(-c3cc(F)cc4c(C5Nc6ccccc6C5(C)C)c[nH]c34)cc21 |
| InChI | InChI=1S/C36H33FN4O/c1-35(2)25-8-5-6-9-27(25)40-33(35)23-17-39-32-21(15-20(37)16-22(23)32)19-12-13-28-26(14-19)36(3,4)34(41-28)24-18-38-29-10-7-11-30(42)31(24)29/h5-6,8-9,12-18,33,38-40H,7,10-11H2,1-4H3 |
| InChIKey | GYBSFQYTFLGHOT-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |