C14H15F16NO2 — CID 123820493
1-(ethylamino)-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononoxy)propan-2-ol (PubChem CID 123820493) has the molecular formula C14H15F16NO2 and a molecular weight of 533.25 g/mol. Its IUPAC name is 1-(ethylamino)-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononoxy)propan-2-ol.
| Compound Name | 1-(ethylamino)-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononoxy)propan-2-ol |
|---|---|
| PubChem CID | 123820493 |
| Molecular Formula | C14H15F16NO2 |
| Molecular Weight | 533.25 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | 1-(ethylamino)-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononoxy)propan-2-ol |
| SMILES | CCNCC(O)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H15F16NO2/c1-2-31-3-6(32)4-33-5-8(17,18)10(21,22)12(25,26)14(29,30)13(27,28)11(23,24)9(19,20)7(15)16/h6-7,31-32H,2-5H2,1H3 |
| InChIKey | SWAHMJFQZUBHHL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.25 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|