About 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium
2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium (PubChem CID 123821049) has the molecular formula C24H42NO+
and a molecular weight of 360.61 g/mol. Its IUPAC name is 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium.
Molecular Properties
| Compound Name | 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium |
| PubChem CID | 123821049 |
| Molecular Formula | C24H42NO+ |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.33 |
| IUPAC Name | 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium |
| SMILES | CC(C)=CCCC(C)=CC[N+](C)(C)CCOC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C24H42NO/c1-18(2)7-6-8-19(3)9-10-25(4,5)11-12-26-24-22-14-20-13-21(16-22)17-23(24)15-20/h7,9,20-24H,6,8,10-17H2,1-5H3/q+1 |
| InChIKey | XXHNTSYKNVAAAT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium?
The IUPAC name of 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium (CID 123821049) is 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium.
What is the SMILES notation for 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium?
The canonical SMILES for 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium is CC(C)=CCCC(C)=CC[N+](C)(C)CCOC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium?
The InChIKey is XXHNTSYKNVAAAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42NO/c1-18(2)7-6-8-19(3)9-10-25(4,5)11-12-26-24-22-14-20-13-21(16-22)17-23(24)15-20/h7,9,20-24H,6,8,10-17H2,1-5H3/q+1.
What are the key properties of 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium?
2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium has a molecular weight of 360.61 g/mol, XLogP of 5.60, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-adamantyloxy)ethyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium is sourced from PubChem (CID 123821049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).