About ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane
ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane (PubChem CID 123821558) has the molecular formula C13H24Si
and a molecular weight of 208.42 g/mol. Its IUPAC name is ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane.
Molecular Properties
| Compound Name | ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane |
| PubChem CID | 123821558 |
| Molecular Formula | C13H24Si |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane |
| SMILES | CC[Si](C)(C)CC1=C(C)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C13H24Si/c1-5-14(3,4)9-13-10(2)11-6-7-12(13)8-11/h11-12H,5-9H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | NDFXAHNZGVWVBM-NWDGAFQWSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane?
The IUPAC name of ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane (CID 123821558) is ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane.
What is the SMILES notation for ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane?
The canonical SMILES for ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane is CC[Si](C)(C)CC1=C(C)[C@H]2CC[C@@H]1C2.
What is the InChIKey of ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane?
The InChIKey is NDFXAHNZGVWVBM-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H24Si/c1-5-14(3,4)9-13-10(2)11-6-7-12(13)8-11/h11-12H,5-9H2,1-4H3/t11-,12+/m0/s1.
What are the key properties of ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane?
ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane has a molecular weight of 208.42 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-dimethyl-[[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]methyl]silane is sourced from PubChem (CID 123821558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).