C22H33N3 — CID 123822464
1-(8a-methyl-2,3-dihydro-1H-naphthalen-1-yl)-N-[3-(4,5-dihydroimidazol-1-yl)butyl]butan-1-imine (PubChem CID 123822464) has the molecular formula C22H33N3 and a molecular weight of 339.53 g/mol. Its IUPAC name is 1-(8a-methyl-2,3-dihydro-1H-naphthalen-1-yl)-N-[3-(4,5-dihydroimidazol-1-yl)butyl]butan-1-imine.
| Compound Name | 1-(8a-methyl-2,3-dihydro-1H-naphthalen-1-yl)-N-[3-(4,5-dihydroimidazol-1-yl)butyl]butan-1-imine |
|---|---|
| PubChem CID | 123822464 |
| Molecular Formula | C22H33N3 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 1-(8a-methyl-2,3-dihydro-1H-naphthalen-1-yl)-N-[3-(4,5-dihydroimidazol-1-yl)butyl]butan-1-imine |
| SMILES | CCC/C(=N\CCC(C)N1C=NCC1)C1CCC=C2C=CC=CC21C |
| InChI | InChI=1S/C22H33N3/c1-4-8-21(24-14-12-18(2)25-16-15-23-17-25)20-11-7-10-19-9-5-6-13-22(19,20)3/h5-6,9-10,13,17-18,20H,4,7-8,11-12,14-16H2,1-3H3/b24-21+ |
| InChIKey | RDYXZRRKDPQCTI-DARPEHSRSA-N |
| XLogP | 4.82 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|