C75H135N3O5 — CID 123823165
N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-N-[8-(3-hexyl-6-methyl-2-octylcyclohexyl)octyl]acetamide (PubChem CID 123823165) has the molecular formula C75H135N3O5 and a molecular weight of 1158.92 g/mol. Its IUPAC name is N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-N-[8-(3-hexyl-6-methyl-2-octylcyclohexyl)octyl]acetamide.
| Compound Name | N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-N-[8-(3-hexyl-6-methyl-2-octylcyclohexyl)octyl]acetamide |
|---|---|
| PubChem CID | 123823165 |
| Molecular Formula | C75H135N3O5 |
| Molecular Weight | 1158.92 g/mol |
| Exact Mass | 1158.04 |
| IUPAC Name | N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-N-[8-(3-hexyl-6-methyl-2-octylcyclohexyl)octyl]acetamide |
| SMILES | CCCCCCCCC1C(CCCCCC)CCC(C)C1CCCCCCCCN(C(C)=O)c1cc(O)n(CCCCCCCCC2C(CCCCCCCCN3C(=O)C=CC3=O)CCC(CCCCCC)C2CCCCCCCC)c1O |
| InChI | InChI=1S/C75H135N3O5/c1-7-11-15-19-28-39-49-68-64(45-35-17-13-9-3)53-52-62(5)67(68)48-38-30-22-25-32-42-58-76(63(6)79)71-61-74(82)78(75(71)83)60-44-34-26-23-31-41-51-70-66(47-37-27-21-24-33-43-59-77-72(80)56-57-73(77)81)55-54-65(46-36-18-14-10-4)69(70)50-40-29-20-16-12-8-2/h56-57,61-62,64-70,82-83H,7-55,58-60H2,1-6H3 |
| InChIKey | MRXUKAGDJHYYNG-UHFFFAOYSA-N |
| XLogP | 22.35 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1158.92 |
| LogP ≤ 5 | 22.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|