C23H20N4O4 — CID 123823181
6-[[2-(4-phenylphenyl)-7H-purin-8-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 123823181) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 6-[[2-(4-phenylphenyl)-7H-purin-8-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | 6-[[2-(4-phenylphenyl)-7H-purin-8-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 123823181 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 6-[[2-(4-phenylphenyl)-7H-purin-8-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | OC1COC2C(Oc3nc4nc(-c5ccc(-c6ccccc6)cc5)ncc4[nH]3)COC12 |
| InChI | InChI=1S/C23H20N4O4/c28-17-11-29-20-18(12-30-19(17)20)31-23-25-16-10-24-21(26-22(16)27-23)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-10,17-20,28H,11-12H2,(H,24,25,26,27) |
| InChIKey | LHMJAIYKKVKAPN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |