C20H21F3O6 — CID 123823191
ethyl 2-[[(2R,6S)-6-(acetyloxymethyl)-3,6-dihydro-2H-pyran-2-yl]oxy]-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 123823191) has the molecular formula C20H21F3O6 and a molecular weight of 414.38 g/mol. Its IUPAC name is ethyl 2-[[(2R,6S)-6-(acetyloxymethyl)-3,6-dihydro-2H-pyran-2-yl]oxy]-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl 2-[[(2R,6S)-6-(acetyloxymethyl)-3,6-dihydro-2H-pyran-2-yl]oxy]-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123823191 |
| Molecular Formula | C20H21F3O6 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | ethyl 2-[[(2R,6S)-6-(acetyloxymethyl)-3,6-dihydro-2H-pyran-2-yl]oxy]-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(=Cc1cccc(C(F)(F)F)c1)O[C@@H]1CC=C[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C20H21F3O6/c1-3-26-19(25)17(11-14-6-4-7-15(10-14)20(21,22)23)29-18-9-5-8-16(28-18)12-27-13(2)24/h4-8,10-11,16,18H,3,9,12H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | BVRDQWAZERLYPW-FUHWJXTLSA-N |
| XLogP | 3.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|