C25H44 — CID 123823195
5-ethyl-1,2,4,5,6,6,7,8,10,12-decamethyltetracyclo[5.4.1.13,11.09,12]tridecane (PubChem CID 123823195) has the molecular formula C25H44 and a molecular weight of 344.63 g/mol. Its IUPAC name is 5-ethyl-1,2,4,5,6,6,7,8,10,12-decamethyltetracyclo[5.4.1.13,11.09,12]tridecane.
| Compound Name | 5-ethyl-1,2,4,5,6,6,7,8,10,12-decamethyltetracyclo[5.4.1.13,11.09,12]tridecane |
|---|---|
| PubChem CID | 123823195 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | 5-ethyl-1,2,4,5,6,6,7,8,10,12-decamethyltetracyclo[5.4.1.13,11.09,12]tridecane |
| SMILES | CCC1(C)C(C)C2CC3C(C)C4C(C)C(C)(C1(C)C)C4(C)C3(C)C2C |
| InChI | InChI=1S/C25H44/c1-12-22(8)15(3)18-13-19-14(2)20-17(5)24(10,21(22,6)7)25(20,11)23(19,9)16(18)4/h14-20H,12-13H2,1-11H3 |
| InChIKey | NXYPLYHTXXXKPM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |