C19H14N2O6 — CID 1238236
2-[(6,7-dimethoxy-4-oxo-4H-3,1-benzoxazin-2-yl)methyl]-1H-isoindole-1,3(2H)-dione (PubChem CID 1238236) has the molecular formula C19H14N2O6 and a molecular weight of 366.30 g/mol. Its IUPAC name is 2-[(6,7-dimethoxy-4-oxo-3,1-benzoxazin-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(6,7-dimethoxy-4-oxo-4H-3,1-benzoxazin-2-yl)methyl]-1H-isoindole-1,3(2H)-dione |
|---|---|
| PubChem CID | 1238236 |
| Molecular Formula | C19H14N2O6 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[(6,7-dimethoxy-4-oxo-3,1-benzoxazin-2-yl)methyl]isoindole-1,3-dione |
| SMILES | COC1=C(C=C2C(=C1)C(=O)OC(=N2)CN3C(=O)C4=CC=CC=C4C3=O)OC |
| InChI | InChI=1S/C19H14N2O6/c1-25-14-7-12-13(8-15(14)26-2)20-16(27-19(12)24)9-21-17(22)10-5-3-4-6-11(10)18(21)23/h3-8H,9H2,1-2H3 |
| InChIKey | UWUCVQSFFRLCFG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | 653 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|