About 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide
2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide (PubChem CID 123823635) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide.
Molecular Properties
| Compound Name | 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide |
| PubChem CID | 123823635 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide |
| SMILES | C=C(C#N)C(=O)NCC(O)CO |
| InChI | InChI=1S/C7H10N2O3/c1-5(2-8)7(12)9-3-6(11)4-10/h6,10-11H,1,3-4H2,(H,9,12) |
| InChIKey | PZLDKPJJWHXIMK-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide?
The IUPAC name of 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide (CID 123823635) is 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide.
What is the SMILES notation for 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide?
The canonical SMILES for 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide is C=C(C#N)C(=O)NCC(O)CO.
What is the InChIKey of 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide?
The InChIKey is PZLDKPJJWHXIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5(2-8)7(12)9-3-6(11)4-10/h6,10-11H,1,3-4H2,(H,9,12).
What are the key properties of 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide?
2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide has a molecular weight of 170.17 g/mol, XLogP of -1.46, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-(2,3-dihydroxypropyl)prop-2-enamide is sourced from PubChem (CID 123823635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).