C23H36ClN3O — CID 123823712
2-[ethyl(propylcarbamoyl)amino]-N,4-dimethyl-6-(5-methylcycloocta-1,3,7-trien-1-yl)hex-2-enimidoyl chloride (PubChem CID 123823712) has the molecular formula C23H36ClN3O and a molecular weight of 406.01 g/mol. Its IUPAC name is 2-[ethyl(propylcarbamoyl)amino]-N,4-dimethyl-6-(5-methylcycloocta-1,3,7-trien-1-yl)hex-2-enimidoyl chloride.
| Compound Name | 2-[ethyl(propylcarbamoyl)amino]-N,4-dimethyl-6-(5-methylcycloocta-1,3,7-trien-1-yl)hex-2-enimidoyl chloride |
|---|---|
| PubChem CID | 123823712 |
| Molecular Formula | C23H36ClN3O |
| Molecular Weight | 406.01 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 2-[ethyl(propylcarbamoyl)amino]-N,4-dimethyl-6-(5-methylcycloocta-1,3,7-trien-1-yl)hex-2-enimidoyl chloride |
| SMILES | CCCNC(=O)N(CC)C(=CC(C)CCC1=CC=CC(C)CC=C1)/C(Cl)=N/C |
| InChI | InChI=1S/C23H36ClN3O/c1-6-16-26-23(28)27(7-2)21(22(24)25-5)17-19(4)14-15-20-12-8-10-18(3)11-9-13-20/h8-10,12-13,17-19H,6-7,11,14-16H2,1-5H3,(H,26,28)/b10-8?,13-9?,20-12?,21-17?,25-22- |
| InChIKey | VDYWLAGWPSREBV-QIDHKMRISA-N |
| XLogP | 6.07 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.01 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|