C22H27F5N6 — CID 123824132
2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[6-(1-fluoroethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine (PubChem CID 123824132) has the molecular formula C22H27F5N6 and a molecular weight of 470.49 g/mol. Its IUPAC name is 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[6-(1-fluoroethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[6-(1-fluoroethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 123824132 |
| Molecular Formula | C22H27F5N6 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[6-(1-fluoroethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(F)c1cccc(-c2nc(NC3CCC(F)(F)CC3)nc(NC3CCC(F)(F)CC3)n2)n1 |
| InChI | InChI=1S/C22H27F5N6/c1-13(23)16-3-2-4-17(30-16)18-31-19(28-14-5-9-21(24,25)10-6-14)33-20(32-18)29-15-7-11-22(26,27)12-8-15/h2-4,13-15H,5-12H2,1H3,(H2,28,29,31,32,33) |
| InChIKey | HKIDBHDGIZDXSI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |