C30H38ClN5O3 — CID 123824170
N-[1-butyl-5-[2-chloro-4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-ethenyl-6-oxo-2-pyridinyl]-2-methyl-N'-(oxan-4-yl)butanimidamide (PubChem CID 123824170) has the molecular formula C30H38ClN5O3 and a molecular weight of 552.12 g/mol. Its IUPAC name is N-[1-butyl-5-[2-chloro-4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-ethenyl-6-oxo-2-pyridinyl]-2-methyl-N'-(oxan-4-yl)butanimidamide.
| Compound Name | N-[1-butyl-5-[2-chloro-4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-ethenyl-6-oxo-2-pyridinyl]-2-methyl-N'-(oxan-4-yl)butanimidamide |
|---|---|
| PubChem CID | 123824170 |
| Molecular Formula | C30H38ClN5O3 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | N-[1-butyl-5-[2-chloro-4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-ethenyl-6-oxo-2-pyridinyl]-2-methyl-N'-(oxan-4-yl)butanimidamide |
| SMILES | C=Cc1cc(-c2ccc(-c3noc(C)n3)cc2Cl)c(=O)n(CCCC)c1N/C(=N/C1CCOCC1)C(C)CC |
| InChI | InChI=1S/C30H38ClN5O3/c1-6-9-14-36-29(34-27(19(4)7-2)33-23-12-15-38-16-13-23)21(8-3)17-25(30(36)37)24-11-10-22(18-26(24)31)28-32-20(5)39-35-28/h8,10-11,17-19,23H,3,6-7,9,12-16H2,1-2,4-5H3,(H,33,34) |
| InChIKey | HBHUQEWRBKNVJI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|