C11H16 — CID 123824370
3,8-dimethylnona-1,3,6,7-tetraene (PubChem CID 123824370) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 3,8-dimethylnona-1,3,6,7-tetraene.
| Compound Name | 3,8-dimethylnona-1,3,6,7-tetraene |
|---|---|
| PubChem CID | 123824370 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 3,8-dimethylnona-1,3,6,7-tetraene |
| SMILES | C=CC(C)=CCC=C=C(C)C |
| InChI | InChI=1S/C11H16/c1-5-11(4)9-7-6-8-10(2)3/h5-6,9H,1,7H2,2-4H3 |
| InChIKey | HQMRWUQJUXEWKQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|