About 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide
4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide (PubChem CID 123824598) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide |
| PubChem CID | 123824598 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide |
| SMILES | CC(C)=C(C)C(=O)NCCC(C)(C)C(N)=O |
| InChI | InChI=1S/C12H22N2O2/c1-8(2)9(3)10(15)14-7-6-12(4,5)11(13)16/h6-7H2,1-5H3,(H2,13,16)(H,14,15) |
| InChIKey | BLZWGBCWDGPLLL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide?
The IUPAC name of 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide (CID 123824598) is 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide.
What is the SMILES notation for 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide?
The canonical SMILES for 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide is CC(C)=C(C)C(=O)NCCC(C)(C)C(N)=O.
What is the InChIKey of 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide?
The InChIKey is BLZWGBCWDGPLLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-8(2)9(3)10(15)14-7-6-12(4,5)11(13)16/h6-7H2,1-5H3,(H2,13,16)(H,14,15).
What are the key properties of 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide?
4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide has a molecular weight of 226.32 g/mol, XLogP of 1.36, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylbut-2-enoylamino)-2,2-dimethylbutanamide is sourced from PubChem (CID 123824598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).