C36H32FN2O+ — CID 123824624
8-[3-(4-cyclopentylphenyl)-5-(2-fluorophenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 123824624) has the molecular formula C36H32FN2O+ and a molecular weight of 527.66 g/mol. Its IUPAC name is 8-[3-(4-cyclopentylphenyl)-5-(2-fluorophenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[3-(4-cyclopentylphenyl)-5-(2-fluorophenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 123824624 |
| Molecular Formula | C36H32FN2O+ |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 8-[3-(4-cyclopentylphenyl)-5-(2-fluorophenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3c(-c4ccc(C5CCCC5)cc4)cc(-c4ccccc4F)c[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C36H32FN2O/c1-22-12-18-29-30-19-13-23(2)38-36(30)40-35(29)33(22)34-31(26-16-14-25(15-17-26)24-8-4-5-9-24)20-27(21-39(34)3)28-10-6-7-11-32(28)37/h6-7,10-21,24H,4-5,8-9H2,1-3H3/q+1 |
| InChIKey | QEIVBZFFVRUUNC-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|