C41H44ClF2N7O — CID 123824771
6-chloro-4-[1-ethyl-4-[(6-fluoro-2-methoxyacridin-9-yl)amino]piperidin-2-yl]-2-fluoro-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine (PubChem CID 123824771) has the molecular formula C41H44ClF2N7O and a molecular weight of 724.30 g/mol. Its IUPAC name is 6-chloro-4-[1-ethyl-4-[(6-fluoro-2-methoxyacridin-9-yl)amino]piperidin-2-yl]-2-fluoro-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine.
| Compound Name | 6-chloro-4-[1-ethyl-4-[(6-fluoro-2-methoxyacridin-9-yl)amino]piperidin-2-yl]-2-fluoro-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine |
|---|---|
| PubChem CID | 123824771 |
| Molecular Formula | C41H44ClF2N7O |
| Molecular Weight | 724.30 g/mol |
| Exact Mass | 723.33 |
| IUPAC Name | 6-chloro-4-[1-ethyl-4-[(6-fluoro-2-methoxyacridin-9-yl)amino]piperidin-2-yl]-2-fluoro-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine |
| SMILES | CCN1CCC(Nc2c3ccc(F)cc3nc3ccc(OC)cc23)CC1c1cc(F)cc2c(NCCN3CCN(C)CC3)c3ccc(Cl)cc3nc12 |
| InChI | InChI=1S/C41H44ClF2N7O/c1-4-51-13-11-28(46-40-31-9-6-26(43)22-37(31)47-35-10-7-29(52-3)24-32(35)40)23-38(51)33-20-27(44)21-34-39(45-12-14-50-17-15-49(2)16-18-50)30-8-5-25(42)19-36(30)48-41(33)34/h5-10,19-22,24,28,38H,4,11-18,23H2,1-3H3,(H,45,48)(H,46,47) |
| InChIKey | PUTRSCQNHDBXEC-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.30 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|