C16H27NO3 — CID 123825073
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]deca-2,4-dienamide (PubChem CID 123825073) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]deca-2,4-dienamide.
| Compound Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]deca-2,4-dienamide |
|---|---|
| PubChem CID | 123825073 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]deca-2,4-dienamide |
| SMILES | CCCCCC=CC=CC(=O)NCC1COC(C)(C)O1 |
| InChI | InChI=1S/C16H27NO3/c1-4-5-6-7-8-9-10-11-15(18)17-12-14-13-19-16(2,3)20-14/h8-11,14H,4-7,12-13H2,1-3H3,(H,17,18) |
| InChIKey | UDLVHMSLOUFPCY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|