C28H49NO4 — CID 123825397
7-(2,5-dihydroxy-1-methylpyrrol-3-yl)-3,3,5,5,12,12,14,14-octamethylpentadec-8-enoic acid (PubChem CID 123825397) has the molecular formula C28H49NO4 and a molecular weight of 463.70 g/mol. Its IUPAC name is 7-(2,5-dihydroxy-1-methylpyrrol-3-yl)-3,3,5,5,12,12,14,14-octamethylpentadec-8-enoic acid.
| Compound Name | 7-(2,5-dihydroxy-1-methylpyrrol-3-yl)-3,3,5,5,12,12,14,14-octamethylpentadec-8-enoic acid |
|---|---|
| PubChem CID | 123825397 |
| Molecular Formula | C28H49NO4 |
| Molecular Weight | 463.70 g/mol |
| Exact Mass | 463.37 |
| IUPAC Name | 7-(2,5-dihydroxy-1-methylpyrrol-3-yl)-3,3,5,5,12,12,14,14-octamethylpentadec-8-enoic acid |
| SMILES | Cn1c(O)cc(C(C=CCCC(C)(C)CC(C)(C)C)CC(C)(C)CC(C)(C)CC(=O)O)c1O |
| InChI | InChI=1S/C28H49NO4/c1-25(2,3)18-26(4,5)14-12-11-13-20(21-15-22(30)29(10)24(21)33)16-27(6,7)19-28(8,9)17-23(31)32/h11,13,15,20,30,33H,12,14,16-19H2,1-10H3,(H,31,32) |
| InChIKey | YWMFJBUZTWUWQL-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|