C27H40N4 — CID 123825486
N-butyl-1-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyrimidin-4-yl]piperidin-4-amine (PubChem CID 123825486) has the molecular formula C27H40N4 and a molecular weight of 420.65 g/mol. Its IUPAC name is N-butyl-1-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyrimidin-4-yl]piperidin-4-amine.
| Compound Name | N-butyl-1-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyrimidin-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 123825486 |
| Molecular Formula | C27H40N4 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.33 |
| IUPAC Name | N-butyl-1-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyrimidin-4-yl]piperidin-4-amine |
| SMILES | CCCCNC1CCN(c2ccnc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)n2)CC1 |
| InChI | InChI=1S/C27H40N4/c1-6-7-15-28-21-11-17-31(18-12-21)24-10-16-29-25(30-24)20-8-9-22-23(19-20)27(4,5)14-13-26(22,2)3/h8-10,16,19,21,28H,6-7,11-15,17-18H2,1-5H3 |
| InChIKey | MXDKRQRCCDPTKS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|