C27H20F5N3O2 — CID 123825608
N-[5-[4-(hydroxymethyl)phenyl]-3-(1-phenylethyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 123825608) has the molecular formula C27H20F5N3O2 and a molecular weight of 513.47 g/mol. Its IUPAC name is N-[5-[4-(hydroxymethyl)phenyl]-3-(1-phenylethyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[5-[4-(hydroxymethyl)phenyl]-3-(1-phenylethyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 123825608 |
| Molecular Formula | C27H20F5N3O2 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N-[5-[4-(hydroxymethyl)phenyl]-3-(1-phenylethyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | CC(c1ccccc1)c1nc(-c2ccc(CO)cc2)cnc1NC(=O)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H20F5N3O2/c1-14(16-5-3-2-4-6-16)26-27(33-12-19(34-26)17-9-7-15(13-36)8-10-17)35-20(37)11-18-21(28)23(30)25(32)24(31)22(18)29/h2-10,12,14,36H,11,13H2,1H3,(H,33,35,37) |
| InChIKey | WQISCIOYXATRAY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|