C20H19FN6O4 — CID 123825714
2-[1-[[2-amino-5-[5-cyano-1-methyl-3-(methylaminooxy)pyrazol-4-yl]-3-pyridinyl]oxy]ethyl]-4-fluorobenzoic acid (PubChem CID 123825714) has the molecular formula C20H19FN6O4 and a molecular weight of 426.41 g/mol. Its IUPAC name is 2-[1-[[2-amino-5-[5-cyano-1-methyl-3-(methylaminooxy)pyrazol-4-yl]-3-pyridinyl]oxy]ethyl]-4-fluorobenzoic acid.
| Compound Name | 2-[1-[[2-amino-5-[5-cyano-1-methyl-3-(methylaminooxy)pyrazol-4-yl]-3-pyridinyl]oxy]ethyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 123825714 |
| Molecular Formula | C20H19FN6O4 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 2-[1-[[2-amino-5-[5-cyano-1-methyl-3-(methylaminooxy)pyrazol-4-yl]-3-pyridinyl]oxy]ethyl]-4-fluorobenzoic acid |
| SMILES | CNOc1nn(C)c(C#N)c1-c1cnc(N)c(OC(C)c2cc(F)ccc2C(=O)O)c1 |
| InChI | InChI=1S/C20H19FN6O4/c1-10(14-7-12(21)4-5-13(14)20(28)29)30-16-6-11(9-25-18(16)23)17-15(8-22)27(3)26-19(17)31-24-2/h4-7,9-10,24H,1-3H3,(H2,23,25)(H,28,29) |
| InChIKey | FBYMCEKCHSXDKJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|