About 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea
1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea (PubChem CID 123826133) has the molecular formula C12H17F3N2O
and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea.
Molecular Properties
| Compound Name | 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea |
| PubChem CID | 123826133 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea |
| SMILES | C=C(/C=C\C(CC)=NC(=O)NCCC)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O/c1-4-8-16-11(18)17-10(5-2)7-6-9(3)12(13,14)15/h6-7H,3-5,8H2,1-2H3,(H,16,18)/b7-6-,17-10? |
| InChIKey | DUXFCUWDPMOWSS-XSPLWLPJSA-N |
| XLogP | 3.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea?
The IUPAC name of 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea (CID 123826133) is 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea.
What is the SMILES notation for 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea?
The canonical SMILES for 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea is C=C(/C=C\C(CC)=NC(=O)NCCC)C(F)(F)F.
What is the InChIKey of 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea?
The InChIKey is DUXFCUWDPMOWSS-XSPLWLPJSA-N. The full InChI is InChI=1S/C12H17F3N2O/c1-4-8-16-11(18)17-10(5-2)7-6-9(3)12(13,14)15/h6-7H,3-5,8H2,1-2H3,(H,16,18)/b7-6-,17-10?.
What are the key properties of 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea?
1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea has a molecular weight of 262.27 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-3-[(4Z)-6-(trifluoromethyl)hepta-4,6-dien-3-ylidene]urea is sourced from PubChem (CID 123826133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).