C16H27N3O3 — CID 123826258
(2S)-N-[(2S,3S)-1-[(2S)-2-formylpyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 123826258) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S)-N-[(2S,3S)-1-[(2S)-2-formylpyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S,3S)-1-[(2S)-2-formylpyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123826258 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (2S)-N-[(2S,3S)-1-[(2S)-2-formylpyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1)C(=O)N1CCC[C@H]1C=O |
| InChI | InChI=1S/C16H27N3O3/c1-3-11(2)14(18-15(21)13-7-4-8-17-13)16(22)19-9-5-6-12(19)10-20/h10-14,17H,3-9H2,1-2H3,(H,18,21)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | BGATYKHZEOTNNA-XUXIUFHCSA-N |
| XLogP | 0.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|