About 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol
2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 123826455) has the molecular formula C7H12FN3O
and a molecular weight of 173.19 g/mol. Its IUPAC name is 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol |
| PubChem CID | 123826455 |
| Molecular Formula | C7H12FN3O |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | OCCn1cnc(CCCF)n1 |
| InChI | InChI=1S/C7H12FN3O/c8-3-1-2-7-9-6-11(10-7)4-5-12/h6,12H,1-5H2 |
| InChIKey | OOQDHKRFOGEVKC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol?
The IUPAC name of 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol (CID 123826455) is 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol.
What is the SMILES notation for 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol?
The canonical SMILES for 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol is OCCn1cnc(CCCF)n1.
What is the InChIKey of 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol?
The InChIKey is OOQDHKRFOGEVKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FN3O/c8-3-1-2-7-9-6-11(10-7)4-5-12/h6,12H,1-5H2.
What are the key properties of 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol?
2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol has a molecular weight of 173.19 g/mol, XLogP of 0.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-fluoropropyl)-1,2,4-triazol-1-yl]ethanol is sourced from PubChem (CID 123826455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).