C10H21NO — CID 123826668
2,3,3,4,4-pentamethylpentanamide (PubChem CID 123826668) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 2,3,3,4,4-pentamethylpentanamide.
| Compound Name | 2,3,3,4,4-pentamethylpentanamide |
|---|---|
| PubChem CID | 123826668 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 2,3,3,4,4-pentamethylpentanamide |
| SMILES | CC(C(N)=O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H21NO/c1-7(8(11)12)10(5,6)9(2,3)4/h7H,1-6H3,(H2,11,12) |
| InChIKey | ZKNBLCZLZFPJTR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |