C23H24ClN3O2S — CID 123826994
2-chloro-N-[3-[5-(3,5-dimethyl-4-prop-2-enoxyphenyl)-1,3,4-thiadiazol-2-yl]propyl]benzamide (PubChem CID 123826994) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-chloro-N-[3-[5-(3,5-dimethyl-4-prop-2-enoxyphenyl)-1,3,4-thiadiazol-2-yl]propyl]benzamide.
| Compound Name | 2-chloro-N-[3-[5-(3,5-dimethyl-4-prop-2-enoxyphenyl)-1,3,4-thiadiazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 123826994 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-chloro-N-[3-[5-(3,5-dimethyl-4-prop-2-enoxyphenyl)-1,3,4-thiadiazol-2-yl]propyl]benzamide |
| SMILES | C=CCOc1c(C)cc(-c2nnc(CCCNC(=O)c3ccccc3Cl)s2)cc1C |
| InChI | InChI=1S/C23H24ClN3O2S/c1-4-12-29-21-15(2)13-17(14-16(21)3)23-27-26-20(30-23)10-7-11-25-22(28)18-8-5-6-9-19(18)24/h4-6,8-9,13-14H,1,7,10-12H2,2-3H3,(H,25,28) |
| InChIKey | HIXONSYXYFCESE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|