C25H21F9N2O2 — CID 123827487
4,4,4-trifluoro-N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-2-(3-methyl-1,2-oxazol-5-yl)ethyl]butanamide (PubChem CID 123827487) has the molecular formula C25H21F9N2O2 and a molecular weight of 552.44 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-2-(3-methyl-1,2-oxazol-5-yl)ethyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-2-(3-methyl-1,2-oxazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 123827487 |
| Molecular Formula | C25H21F9N2O2 |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 4,4,4-trifluoro-N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-2-(3-methyl-1,2-oxazol-5-yl)ethyl]butanamide |
| SMILES | Cc1cc(C[C@@](NC(=O)CCC(F)(F)F)(c2ccc(F)cc2)c2cc(F)cc(CC(F)(F)C(F)F)c2)on1 |
| InChI | InChI=1S/C25H21F9N2O2/c1-14-8-20(38-36-14)13-23(16-2-4-18(26)5-3-16,35-21(37)6-7-25(32,33)34)17-9-15(10-19(27)11-17)12-24(30,31)22(28)29/h2-5,8-11,22H,6-7,12-13H2,1H3,(H,35,37)/t23-/m1/s1 |
| InChIKey | MHZVOFQCYJTFIR-HSZRJFAPSA-N |
| XLogP | 6.65 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|